CAS 2121512-80-7 appears in our catalog under these names: 2-Benzyloxy-4,5-dimethylphenylboronic acid, 95%, 2-Benzyloxy-4,5-dimethylphenylboronic acid, ≥95%, ≥95%, 2-Benzyloxy-4,5-dimethylphenylboronic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g.
(4,5-dimethyl-2-phenylmethoxyphenyl)boronic acid (CAS 2121512-80-7) is a chemical compound with the molecular formula C15H17BO3 and a molecular weight of 256.11 g/mol. IUPAC name: (4,5-dimethyl-2-phenylmethoxyphenyl)boronic acid. InChIKey: ZDNNLFRTSPULKU-UHFFFAOYSA-N.
| Molecular formula | C15H17BO3 |
|---|---|
| Molecular weight | 256.11 g/mol |
| IUPAC name | (4,5-dimethyl-2-phenylmethoxyphenyl)boronic acid |
| InChIKey | ZDNNLFRTSPULKU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OCC2=CC=CC=C2)C)C)(O)O |
Computed by PubChem (NCBI)