cas: 61323-17-9 — see every product listed under this CAS number, including other names
2-Bromo-1,8-naphthyridine 95% (CAS 61323-17-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A648943-10g |
| cas | 61323-17-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 5232.00 Pln | |
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 426.00 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 3107.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A648943 |
2-bromo-1,8-naphthyridine (CAS 61323-17-9) is a chemical compound with the molecular formula C8H5BrN2 and a molecular weight of 209.04 g/mol. IUPAC name: 2-bromo-1,8-naphthyridine. InChIKey: BCMGOTDNNMLUBS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2 |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 2-bromo-1,8-naphthyridine |
| InChIKey | BCMGOTDNNMLUBS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)N=C(C=C2)Br |
Computed by PubChem (NCBI)