cas: 61323-17-9 — see every product listed under this CAS number, including other names
2-Bromo-1,8-naphthyridine, 97%, 97% (CAS 61323-17-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E08V-50mg |
| cas | 61323-17-9 |
| size | 50mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 117.20 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 544.40 Pln | |
| Chemat | 5g | 1715.60 Pln | |
| Chemat | 10g | 2958.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1,8-naphthyridine (CAS 61323-17-9) is a chemical compound with the molecular formula C8H5BrN2 and a molecular weight of 209.04 g/mol. IUPAC name: 2-bromo-1,8-naphthyridine. InChIKey: BCMGOTDNNMLUBS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2 |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 2-bromo-1,8-naphthyridine |
| InChIKey | BCMGOTDNNMLUBS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)N=C(C=C2)Br |
Computed by PubChem (NCBI)