cas: 2491-39-6 — see every product listed under this CAS number, including other names
2-Bromo-1-(2,4-dihydroxyphenyl)ethanone 95% (CAS 2491-39-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A860544-100mg |
| cas | 2491-39-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 726.38 Pln | |
| Ambeed | 5g | 2033.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A860544 |
2-bromo-1-(2,4-dihydroxyphenyl)ethanone (CAS 2491-39-6) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-bromo-1-(2,4-dihydroxyphenyl)ethanone. InChIKey: RAULLGKGLGXMOM-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-bromo-1-(2,4-dihydroxyphenyl)ethanone |
| InChIKey | RAULLGKGLGXMOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)O)C(=O)CBr |
Computed by PubChem (NCBI)