cas: 34911-51-8 — see every product listed under this CAS number, including other names
2-Bromo-1-(3-chlorophenyl)propan-1-one, 95% (CAS 34911-51-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236724-1G |
| cas | 34911-51-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 5g | 91.65 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 154.13 Pln | |
| Fluorochem | 100g | 310.33 Pln | |
| Fluorochem | 250g | 612.30 Pln | |
| Fluorochem | 500g | 862.21 Pln | |
| Fluorochem | 1kg | 1393.28 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-bromo-1-(3-chlorophenyl)propan-1-one (CAS 34911-51-8) is a chemical compound with the molecular formula C9H8BrClO and a molecular weight of 247.51 g/mol. IUPAC name: 2-bromo-1-(3-chlorophenyl)propan-1-one. InChIKey: OFNMQTRHMBQQEA-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO |
|---|---|
| Molecular weight | 247.51 g/mol |
| IUPAC name | 2-bromo-1-(3-chlorophenyl)propan-1-one |
| InChIKey | OFNMQTRHMBQQEA-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC=C1)Cl)Br |
Computed by PubChem (NCBI)