cas: 34911-51-8 — see every product listed under this CAS number, including other names
Bupropion impurity 13, 97.65% (CAS 34911-51-8) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 5 g, 1 kg, 25 g, 100 g, 500 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W004079-10 g |
| cas | 34911-51-8 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 287.18 Pln | |
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 1 kg | 1582.86 Pln | |
| MedChemExpress | 25 g | 407.93 Pln | |
| MedChemExpress | 100 g | 649.42 Pln | |
| MedChemExpress | 500 g | 1081.31 Pln | |
| MedChemExpress | 50 g | 510.10 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.65% |
2-bromo-1-(3-chlorophenyl)propan-1-one (CAS 34911-51-8) is a chemical compound with the molecular formula C9H8BrClO and a molecular weight of 247.51 g/mol. IUPAC name: 2-bromo-1-(3-chlorophenyl)propan-1-one. InChIKey: OFNMQTRHMBQQEA-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO |
|---|---|
| Molecular weight | 247.51 g/mol |
| IUPAC name | 2-bromo-1-(3-chlorophenyl)propan-1-one |
| InChIKey | OFNMQTRHMBQQEA-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC=C1)Cl)Br |
Computed by PubChem (NCBI)