cas: 877-37-2 — see every product listed under this CAS number, including other names
2-Bromo-1-(4-chloro-phenyl)-propan-1-one, 95% (CAS 877-37-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F511317-1G |
| cas | 877-37-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 575.86 Pln | |
| Fluorochem | 5g | 1762.94 Pln | |
| Fluorochem | 10g | 2814.65 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-1-(4-chlorophenyl)propan-1-one (CAS 877-37-2) is a chemical compound with the molecular formula C9H8BrClO and a molecular weight of 247.51 g/mol. IUPAC name: 2-bromo-1-(4-chlorophenyl)propan-1-one. InChIKey: SAKMPXRILWVZEG-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO |
|---|---|
| Molecular weight | 247.51 g/mol |
| IUPAC name | 2-bromo-1-(4-chlorophenyl)propan-1-one |
| InChIKey | SAKMPXRILWVZEG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)Cl)Br |
Computed by PubChem (NCBI)