cas: 877-37-2 — see every product listed under this CAS number, including other names
2-Bromo-4'-chloropropiophenone, 98.0% (CAS 877-37-2) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 250 mg, 100 mg, 500 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W045376-1 g |
| cas | 877-37-2 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 937.34 Pln | |
| MedChemExpress | 250 mg | 431.15 Pln | |
| MedChemExpress | 100 mg | 273.25 Pln | |
| MedChemExpress | 500 mg | 621.55 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
2-bromo-1-(4-chlorophenyl)propan-1-one (CAS 877-37-2) is a chemical compound with the molecular formula C9H8BrClO and a molecular weight of 247.51 g/mol. IUPAC name: 2-bromo-1-(4-chlorophenyl)propan-1-one. InChIKey: SAKMPXRILWVZEG-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO |
|---|---|
| Molecular weight | 247.51 g/mol |
| IUPAC name | 2-bromo-1-(4-chlorophenyl)propan-1-one |
| InChIKey | SAKMPXRILWVZEG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)Cl)Br |
Computed by PubChem (NCBI)