CAS 126581-65-5 is the registry number for 2-Bromo-1-(5-fluoro-2-hydroxyphenyl)ethanone, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
2-bromo-1-(5-fluoro-2-hydroxyphenyl)ethanone (CAS 126581-65-5) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-bromo-1-(5-fluoro-2-hydroxyphenyl)ethanone. InChIKey: QFYYHGPQMZTLRB-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-bromo-1-(5-fluoro-2-hydroxyphenyl)ethanone |
| InChIKey | QFYYHGPQMZTLRB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)CBr)O |
Computed by PubChem (NCBI)