CAS 739336-26-6 appears in our catalog under these names: 2-Bromo-5-fluorophenylacetic acid, 98%, 2-Bromo-5-fluorophenyl acetic acid, 96% , 2-Bromo-5-fluorophenylacetic acid 98%, 2-Bromo-5-fluorophenylacetic acid, 97%, 97%, 2-Bromo-5-fluorophenylacetic acid, 97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 500g, 5g, 100g, 1g, 250mg, 10g, 1000g.
2-(2-bromo-5-fluorophenyl)acetic acid (CAS 739336-26-6) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-(2-bromo-5-fluorophenyl)acetic acid. InChIKey: BPNWLZNAKZSBHH-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-(2-bromo-5-fluorophenyl)acetic acid |
| InChIKey | BPNWLZNAKZSBHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CC(=O)O)Br |
Computed by PubChem (NCBI)