CAS 194019-11-9 appears in our catalog under these names: 3-Bromo-4-fluorophenylacetic acid, 98%, 3–Bromo–4–fluorophenylacetic Acid, 3-Bromo-4-fluorophenylacetic Acid, >97.0%(GC)(T), 3-Bromo-4-fluorophenylacetic acid, 98%, 98%, 3-Bromo-4-fluorophenylacetic acid, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 20g, 500g.
2-(3-bromo-4-fluorophenyl)acetic acid (CAS 194019-11-9) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-(3-bromo-4-fluorophenyl)acetic acid. InChIKey: XXFGIJYSXNXNAU-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-(3-bromo-4-fluorophenyl)acetic acid |
| InChIKey | XXFGIJYSXNXNAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)Br)F |
Computed by PubChem (NCBI)