cas: 914635-64-6 — see every product listed under this CAS number, including other names
2-Bromo-1-methoxy-3-(trifluoromethyl)benzene 97% (CAS 914635-64-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A231553-10g |
| cas | 914635-64-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 2511.94 Pln | |
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 503.88 Pln | |
| Ambeed | 5g | 1594.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A231553 |
2-bromo-1-methoxy-3-(trifluoromethyl)benzene (CAS 914635-64-6) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: 2-bromo-1-methoxy-3-(trifluoromethyl)benzene. InChIKey: PGUOFURUIKCHKC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 2-bromo-1-methoxy-3-(trifluoromethyl)benzene |
| InChIKey | PGUOFURUIKCHKC-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1Br)C(F)(F)F |
Computed by PubChem (NCBI)