cas: 6851-99-6 — see every product listed under this CAS number, including other names
2-Bromo-2'-nitroacetophenone, >98.0%(GC) (CAS 6851-99-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B3528-5G |
| cas | 6851-99-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 355.86 Pln | |
| TCI | 25g | 1073.78 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2-bromo-1-(2-nitrophenyl)ethanone (CAS 6851-99-6) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 2-bromo-1-(2-nitrophenyl)ethanone. InChIKey: SGXUUCSRVVSMGK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 2-bromo-1-(2-nitrophenyl)ethanone |
| InChIKey | SGXUUCSRVVSMGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)