cas: 29270-30-2 — see every product listed under this CAS number, including other names
2-Bromo-2-(2-chlorophenyl)acetic acid 97% (CAS 29270-30-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A638540-5g |
| cas | 29270-30-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 854.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A638540 |
2-bromo-2-(2-chlorophenyl)acetic acid (CAS 29270-30-2) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 2-bromo-2-(2-chlorophenyl)acetic acid. InChIKey: XHAPROULWZYBGA-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 2-bromo-2-(2-chlorophenyl)acetic acid |
| InChIKey | XHAPROULWZYBGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)Br)Cl |
Computed by PubChem (NCBI)