cas: 1056264-66-4 — see every product listed under this CAS number, including other names
2-Bromo-3-chloro-6-fluorobenzaldehyde, 98% (CAS 1056264-66-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F412028-1G |
| cas | 1056264-66-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 268.67 Pln | |
| Fluorochem | 25g | 518.59 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-3-chloro-6-fluorobenzaldehyde (CAS 1056264-66-4) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 2-bromo-3-chloro-6-fluorobenzaldehyde. InChIKey: XDWZRCXBBQWCBS-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 2-bromo-3-chloro-6-fluorobenzaldehyde |
| InChIKey | XDWZRCXBBQWCBS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C=O)Br)Cl |
Computed by PubChem (NCBI)