CAS 773140-42-4 appears in our catalog under these names: 5-Bromo-2-fluorobenzoyl chloride, 95%, 5-Bromo-2-fluorobenzoyl chloride 95+%, 5-Bromo-2-fluorobenzoyl chloride. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 25g, 100g, 10g, 1g, 5g, 250mg.
5-bromo-2-fluorobenzoyl chloride (CAS 773140-42-4) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 5-bromo-2-fluorobenzoyl chloride. InChIKey: LEGBISULKASFCD-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 5-bromo-2-fluorobenzoyl chloride |
| InChIKey | LEGBISULKASFCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)Cl)F |
Computed by PubChem (NCBI)