cas: 35757-20-1 — see every product listed under this CAS number, including other names
2-Bromo-3-nitroaniline, 97%, 97% (CAS 35757-20-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CIU1-100mg |
| cas | 35757-20-1 |
| size | 100mg |
| availability | 14g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 371.60 Pln | |
| Chemat | 1g | 818.00 Pln | |
| Chemat | 5g | 2819.60 Pln | |
| Chemat | 10g | 4816.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-3-nitroaniline (CAS 35757-20-1) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 2-bromo-3-nitroaniline. InChIKey: GDKBUWQOCGJBFX-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 2-bromo-3-nitroaniline |
| InChIKey | GDKBUWQOCGJBFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Br)N |
Computed by PubChem (NCBI)