cas: 35757-20-1 — see every product listed under this CAS number, including other names
2-Bromo-3-nitroaniline, 98% (CAS 35757-20-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F231260-1G |
| cas | 35757-20-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 674.78 Pln | |
| Fluorochem | 5g | 2377.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-3-nitroaniline (CAS 35757-20-1) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 2-bromo-3-nitroaniline. InChIKey: GDKBUWQOCGJBFX-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 2-bromo-3-nitroaniline |
| InChIKey | GDKBUWQOCGJBFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Br)N |
Computed by PubChem (NCBI)