cas: 4697-62-5 — see every product listed under this CAS number, including other names
2-Bromo-4,5-dimethoxyphenylacetic acid, 96%, 96% (CAS 4697-62-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D9PG-250mg |
| cas | 4697-62-5 |
| size | 250mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 1086.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(2-bromo-4,5-dimethoxyphenyl)acetic acid (CAS 4697-62-5) is a chemical compound with the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. IUPAC name: 2-(2-bromo-4,5-dimethoxyphenyl)acetic acid. InChIKey: MDOLAGJKKZEHHW-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO4 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | 2-(2-bromo-4,5-dimethoxyphenyl)acetic acid |
| InChIKey | MDOLAGJKKZEHHW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CC(=O)O)Br)OC |
Computed by PubChem (NCBI)