CAS 4697-62-5 appears in our catalog under these names: 2-Bromo-4,5-dimethoxyphenylacetic acid, 97%, 2-Bromo-4,5-dimethoxyphenylacetic acid, 2-Bromo-4,5-dimethoxyphenylacetic acid, 96%, 96%, 2-Bromo-4,5-dimethoxyphenylacetic acid, min. 95 %, 1 g, 2-Bromo-4,5-dimethoxyphenylacetic acid, min. 95 %, 2 g. Offered by: Combi-blocks, Biosynth, Chemat, Roth, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 2g, 250mg.
2-(2-bromo-4,5-dimethoxyphenyl)acetic acid (CAS 4697-62-5) is a chemical compound with the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. IUPAC name: 2-(2-bromo-4,5-dimethoxyphenyl)acetic acid. InChIKey: MDOLAGJKKZEHHW-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO4 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | 2-(2-bromo-4,5-dimethoxyphenyl)acetic acid |
| InChIKey | MDOLAGJKKZEHHW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CC(=O)O)Br)OC |
Computed by PubChem (NCBI)