Products 62176-28-7

CAS 62176-28-7 is the registry number for 5-Bromo-2-(2-methoxyethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-bromo-2-(2-methoxyethoxy)benzoic acid (CAS 62176-28-7) is a chemical compound with the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. IUPAC name: 5-bromo-2-(2-methoxyethoxy)benzoic acid. InChIKey: IJQKYTRADZFFTK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrO4
Molecular weight275.10 g/mol
IUPAC name5-bromo-2-(2-methoxyethoxy)benzoic acid
InChIKeyIJQKYTRADZFFTK-UHFFFAOYSA-N
SMILESCOCCOC1=C(C=C(C=C1)Br)C(=O)O

Computed by PubChem (NCBI)