CAS 65977-12-0 appears in our catalog under these names: Methyl 3-bromo-2,6-dimethoxybenzoate, 95%, Methyl 3-bromo-2,6-dimethoxybenzoate, 97%, Methyl 3-bromo-2,6-dimethoxybenzoate, ≥95%, ≥95%, Methyl 3-bromo-2,6-dimethoxybenzoate, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g.
Methyl 3-bromo-2,6-dimethoxybenzoate (CAS 65977-12-0) is a chemical compound with the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. IUPAC name: methyl 3-bromo-2,6-dimethoxybenzoate. InChIKey: IYVSXIFYVRNTDY-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO4 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | methyl 3-bromo-2,6-dimethoxybenzoate |
| InChIKey | IYVSXIFYVRNTDY-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)OC)C(=O)OC |
Computed by PubChem (NCBI)