CAS 19491-18-0 is the registry number for Methyl 2-bromo-3,5-dimethoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-bromo-3,5-dimethoxybenzoate (CAS 19491-18-0) is a chemical compound with the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. IUPAC name: methyl 2-bromo-3,5-dimethoxybenzoate. InChIKey: HQWVUYIQYUMGDT-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO4 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | methyl 2-bromo-3,5-dimethoxybenzoate |
| InChIKey | HQWVUYIQYUMGDT-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)Br)C(=O)OC |
Computed by PubChem (NCBI)