Products 19491-18-0

CAS 19491-18-0 is the registry number for Methyl 2-bromo-3,5-dimethoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-bromo-3,5-dimethoxybenzoate (CAS 19491-18-0) is a chemical compound with the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. IUPAC name: methyl 2-bromo-3,5-dimethoxybenzoate. InChIKey: HQWVUYIQYUMGDT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrO4
Molecular weight275.10 g/mol
IUPAC namemethyl 2-bromo-3,5-dimethoxybenzoate
InChIKeyHQWVUYIQYUMGDT-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C(=C1)OC)Br)C(=O)OC

Computed by PubChem (NCBI)