CAS 915874-00-9 appears in our catalog under these names: 2-Bromo-5-ethoxy-4-methoxybenzoic acid, 95%, 2-Bromo-5-ethoxy-4-methoxybenzoic acid, 97%, 2-Bromo-5-ethoxy-4-methoxybenzoic acid 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg.
2-bromo-5-ethoxy-4-methoxybenzoic acid (CAS 915874-00-9) is a chemical compound with the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. IUPAC name: 2-bromo-5-ethoxy-4-methoxybenzoic acid. InChIKey: DVXLGUUTNVHMDI-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO4 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | 2-bromo-5-ethoxy-4-methoxybenzoic acid |
| InChIKey | DVXLGUUTNVHMDI-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)C(=O)O)Br)OC |
Computed by PubChem (NCBI)