cas: 71795-72-7 — see every product listed under this CAS number, including other names
2-Bromo-4,5-dimethylbenzenesulfonyl chloride (CAS 71795-72-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F061605-1G |
| cas | 71795-72-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1013.20 Pln |
| delivery time | 2-3 weeks |
|---|
2-bromo-4,5-dimethylbenzenesulfonyl chloride (CAS 71795-72-7) is a chemical compound with the molecular formula C8H8BrClO2S and a molecular weight of 283.57 g/mol. IUPAC name: 2-bromo-4,5-dimethylbenzenesulfonyl chloride. InChIKey: LOSWVTPOIIAILQ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO2S |
|---|---|
| Molecular weight | 283.57 g/mol |
| IUPAC name | 2-bromo-4,5-dimethylbenzenesulfonyl chloride |
| InChIKey | LOSWVTPOIIAILQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)