CAS 14207-30-8 appears in our catalog under these names: 4-Bromo-2,5-dimethylbenzene-1-sulfonyl chloride, 95%, 4-Bromo-2,5-dimethylbenzenesulfonyl Chloride, 4-bromo-2,5-dimethylbenzenesulfonyl chloride, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 200umol, 10g, 1g, 5g.
4-bromo-2,5-dimethylbenzenesulfonyl chloride (CAS 14207-30-8) is a chemical compound with the molecular formula C8H8BrClO2S and a molecular weight of 283.57 g/mol. IUPAC name: 4-bromo-2,5-dimethylbenzenesulfonyl chloride. InChIKey: NTZAPNSSTHUFND-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO2S |
|---|---|
| Molecular weight | 283.57 g/mol |
| IUPAC name | 4-bromo-2,5-dimethylbenzenesulfonyl chloride |
| InChIKey | NTZAPNSSTHUFND-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)