CAS 71795-72-7 appears in our catalog under these names: 2-Bromo-4,5-dimethylbenzenesulfonyl chloride, 95%, 2-Bromo-4,5-dimethylbenzenesulfonyl chloride. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g.
2-bromo-4,5-dimethylbenzenesulfonyl chloride (CAS 71795-72-7) is a chemical compound with the molecular formula C8H8BrClO2S and a molecular weight of 283.57 g/mol. IUPAC name: 2-bromo-4,5-dimethylbenzenesulfonyl chloride. InChIKey: LOSWVTPOIIAILQ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO2S |
|---|---|
| Molecular weight | 283.57 g/mol |
| IUPAC name | 2-bromo-4,5-dimethylbenzenesulfonyl chloride |
| InChIKey | LOSWVTPOIIAILQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)