CAS 351003-50-4 is the registry number for 4-Bromo-2,6-dimethylbenzene-1-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-bromo-2,6-dimethylbenzenesulfonyl chloride (CAS 351003-50-4) is a chemical compound with the molecular formula C8H8BrClO2S and a molecular weight of 283.57 g/mol. IUPAC name: 4-bromo-2,6-dimethylbenzenesulfonyl chloride. InChIKey: VTPRHRFUFYYYRR-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO2S |
|---|---|
| Molecular weight | 283.57 g/mol |
| IUPAC name | 4-bromo-2,6-dimethylbenzenesulfonyl chloride |
| InChIKey | VTPRHRFUFYYYRR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1S(=O)(=O)Cl)C)Br |
Computed by PubChem (NCBI)