cas: 79352-66-2 — see every product listed under this CAS number, including other names
2-Bromo-4-(phenylmethoxy)phenol, 95%, 95% (CAS 79352-66-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0Y0-100mg |
| cas | 79352-66-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 674.00 Pln | |
| Chemat | 5g | 1874.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-bromo-4-phenylmethoxyphenol (CAS 79352-66-2) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: 2-bromo-4-phenylmethoxyphenol. InChIKey: HIGLPWLKZYKDNL-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | 2-bromo-4-phenylmethoxyphenol |
| InChIKey | HIGLPWLKZYKDNL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)O)Br |
Computed by PubChem (NCBI)