cas: 1214366-07-0 — see every product listed under this CAS number, including other names
2-Bromo-4-(trifluoromethoxy)benzoic acid methyl ester (CAS 1214366-07-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632451-1G |
| cas | 1214366-07-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2434.58 Pln | |
| Fluorochem | 5g | 7156.87 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 2-bromo-4-(trifluoromethoxy)benzoate (CAS 1214366-07-0) is a chemical compound with the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. IUPAC name: methyl 2-bromo-4-(trifluoromethoxy)benzoate. InChIKey: GKHWRWXANBVFOJ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O3 |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | methyl 2-bromo-4-(trifluoromethoxy)benzoate |
| InChIKey | GKHWRWXANBVFOJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)OC(F)(F)F)Br |
Computed by PubChem (NCBI)