cas: 1214334-83-4 — see every product listed under this CAS number, including other names
2-Bromo-4-(trifluoromethoxy)benzonitrile 97% (CAS 1214334-83-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A408561-5g |
| cas | 1214334-83-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 214.62 Pln | |
| Ambeed | 25g | 665.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A408561 |
2-bromo-4-(trifluoromethoxy)benzonitrile (CAS 1214334-83-4) is a chemical compound with the molecular formula C8H3BrF3NO and a molecular weight of 266.01 g/mol. IUPAC name: 2-bromo-4-(trifluoromethoxy)benzonitrile. InChIKey: KQXCJMGFMNVWGL-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NO |
|---|---|
| Molecular weight | 266.01 g/mol |
| IUPAC name | 2-bromo-4-(trifluoromethoxy)benzonitrile |
| InChIKey | KQXCJMGFMNVWGL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Br)C#N |
Computed by PubChem (NCBI)