cas: 1214334-83-4 — see every product listed under this CAS number, including other names
2-bromo-4-(trifluoromethoxy)benzonitrile, 99+%, 99+% (CAS 1214334-83-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1125SV-10g |
| cas | 1214334-83-4 |
| size | 10g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 208.40 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 25g | 424.40 Pln | |
| Chemat | 100g | 1499.60 Pln |
| purity | 99+% |
|---|---|
| delivery time | 3 weeks |
2-bromo-4-(trifluoromethoxy)benzonitrile (CAS 1214334-83-4) is a chemical compound with the molecular formula C8H3BrF3NO and a molecular weight of 266.01 g/mol. IUPAC name: 2-bromo-4-(trifluoromethoxy)benzonitrile. InChIKey: KQXCJMGFMNVWGL-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NO |
|---|---|
| Molecular weight | 266.01 g/mol |
| IUPAC name | 2-bromo-4-(trifluoromethoxy)benzonitrile |
| InChIKey | KQXCJMGFMNVWGL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Br)C#N |
Computed by PubChem (NCBI)