CAS 375369-08-7 appears in our catalog under these names: Benzoxazole, 5-bromo-2-(trifluoromethyl)-, 95%, 5-Bromo-2-(trifluoromethyl)-1,3-benzoxazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 50mg, 0,5g.
5-bromo-2-(trifluoromethyl)-1,3-benzoxazole (CAS 375369-08-7) is a chemical compound with the molecular formula C8H3BrF3NO and a molecular weight of 266.01 g/mol. IUPAC name: 5-bromo-2-(trifluoromethyl)-1,3-benzoxazole. InChIKey: QXYGGLIKWPKXBX-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NO |
|---|---|
| Molecular weight | 266.01 g/mol |
| IUPAC name | 5-bromo-2-(trifluoromethyl)-1,3-benzoxazole |
| InChIKey | QXYGGLIKWPKXBX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)N=C(O2)C(F)(F)F |
Computed by PubChem (NCBI)