CAS 217326-71-1 is the registry number for 4-Bromo-2-(trifluoromethyl)-1,3-benzoxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-bromo-2-(trifluoromethyl)-1,3-benzoxazole (CAS 217326-71-1) is a chemical compound with the molecular formula C8H3BrF3NO and a molecular weight of 266.01 g/mol. IUPAC name: 4-bromo-2-(trifluoromethyl)-1,3-benzoxazole. InChIKey: MHXHEGALWVDEIZ-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NO |
|---|---|
| Molecular weight | 266.01 g/mol |
| IUPAC name | 4-bromo-2-(trifluoromethyl)-1,3-benzoxazole |
| InChIKey | MHXHEGALWVDEIZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=C(O2)C(F)(F)F |
Computed by PubChem (NCBI)