cas: 1214334-83-4 — see every product listed under this CAS number, including other names
2-Bromo-4-(trifluoromethoxy)benzonitrile 99+% (CAS 1214334-83-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1475895-1g |
| cas | 1214334-83-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 248.00 Pln | |
| Ambeed | 25g | 615.13 Pln | |
| Ambeed | 100g | 2244.94 Pln |
| purity | 99+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1475895 |
2-bromo-4-(trifluoromethoxy)benzonitrile (CAS 1214334-83-4) is a chemical compound with the molecular formula C8H3BrF3NO and a molecular weight of 266.01 g/mol. IUPAC name: 2-bromo-4-(trifluoromethoxy)benzonitrile. InChIKey: KQXCJMGFMNVWGL-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NO |
|---|---|
| Molecular weight | 266.01 g/mol |
| IUPAC name | 2-bromo-4-(trifluoromethoxy)benzonitrile |
| InChIKey | KQXCJMGFMNVWGL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Br)C#N |
Computed by PubChem (NCBI)