Products 928136-78-1
CAS 928136-78-1 appears in our catalog under these names: 4-Bromo-3-(trifluoromethoxy)benzonitrile, 98%, 4–Bromo–3–(Trifluoromethoxy)Benzonitrile. Offered by: Combi-blocks, GLPBio, Fluorochem, Ambeed. Available pack sizes: 10g, 100g, 1g, 5g, 25g.
4-bromo-3-(trifluoromethoxy)benzonitrile (CAS 928136-78-1) is a chemical compound with the molecular formula C8H3BrF3NO and a molecular weight of 266.01 g/mol. IUPAC name: 4-bromo-3-(trifluoromethoxy)benzonitrile. InChIKey: QQCRVTNJCBKIBH-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NO |
|---|---|
| Molecular weight | 266.01 g/mol |
| IUPAC name | 4-bromo-3-(trifluoromethoxy)benzonitrile |
| InChIKey | QQCRVTNJCBKIBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)OC(F)(F)F)Br |
Computed by PubChem (NCBI)