CAS 328-89-2 appears in our catalog under these names: 2-Bromo-4-(trifluoromethyl)benzoic acid, 98% , 2-Bromo-4-(trifluoromethyl)benzoic acid, 95%, 2-Bromo-4-(trifluoromethyl)benzoic acid, 98%, 98%, 2-Bromo-4-(trifluoromethyl)benzoic Acid, >98.0%(GC)(T). Offered by: Thermo Scientific (Alfa Aesar), Fluorochem, Chemat, TCI. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g.
2-bromo-4-(trifluoromethyl)benzoic acid (CAS 328-89-2) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 2-bromo-4-(trifluoromethyl)benzoic acid. InChIKey: SINIIFNWZPCJGU-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 2-bromo-4-(trifluoromethyl)benzoic acid |
| InChIKey | SINIIFNWZPCJGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)C(=O)O |
Computed by PubChem (NCBI)