Products 581813-17-4
CAS 581813-17-4 appears in our catalog under these names: 3-Bromo-4-(trifluoromethyl)benzoic acid, 97%, 3-Bromo-4-(trifluoromethyl)benzoic acid 95%, 3-Bromo-4-(trifluoromethyl)benzoic acid, 95%, 3-Bromo-4-(trifluoromethyl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 250mg, 50g.
3-bromo-4-(trifluoromethyl)benzoic acid (CAS 581813-17-4) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 3-bromo-4-(trifluoromethyl)benzoic acid. InChIKey: OWNPWXHFRGDHMC-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 3-bromo-4-(trifluoromethyl)benzoic acid |
| InChIKey | OWNPWXHFRGDHMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Br)C(F)(F)F |
Computed by PubChem (NCBI)