CAS 1221716-04-6 appears in our catalog under these names: 4-Bromo-3-(trifluoromethoxy)benzaldehyde, 95%, 4-Bromo-3-(trifluoromethoxy)benzaldehyde 95%, 4-bromo-3-(trifluoromethoxy)benzaldehyde, 95%, 95%, 4-Bromo-3-(trifluoromethoxy)benzaldehyde. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
4-bromo-3-(trifluoromethoxy)benzaldehyde (CAS 1221716-04-6) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 4-bromo-3-(trifluoromethoxy)benzaldehyde. InChIKey: OXGOZHICCQUYTM-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 4-bromo-3-(trifluoromethoxy)benzaldehyde |
| InChIKey | OXGOZHICCQUYTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)OC(F)(F)F)Br |
Computed by PubChem (NCBI)