CAS 1190130-82-5 appears in our catalog under these names: 1-(5-Bromo-2-hydroxyphenyl)-2,2,2-trifluoroethan-1-one, 95%, 1-(5-Bromo-2-hydroxyphenyl)-2,2,2-trifluoroethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g.
1-(5-bromo-2-hydroxyphenyl)-2,2,2-trifluoroethanone (CAS 1190130-82-5) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 1-(5-bromo-2-hydroxyphenyl)-2,2,2-trifluoroethanone. InChIKey: DDGPMWKNKPLJCW-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 1-(5-bromo-2-hydroxyphenyl)-2,2,2-trifluoroethanone |
| InChIKey | DDGPMWKNKPLJCW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)C(F)(F)F)O |
Computed by PubChem (NCBI)