CAS 1525649-77-7 is the registry number for Methyl 6-bromo-2,3,4-trifluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Methyl 6-bromo-2,3,4-trifluorobenzoate (CAS 1525649-77-7) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: methyl 6-bromo-2,3,4-trifluorobenzoate. InChIKey: SPSGBYHEYYSGKR-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | methyl 6-bromo-2,3,4-trifluorobenzoate |
| InChIKey | SPSGBYHEYYSGKR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C(=C1F)F)F)Br |
Computed by PubChem (NCBI)