CAS 530145-59-6 appears in our catalog under these names: Methyl 5-bromo-2,3,4-trifluorobenzoate, 95%, Methyl 5-bromo-2,3,4-trifluorobenzoate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Methyl 5-bromo-2,3,4-trifluorobenzoate (CAS 530145-59-6) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: methyl 5-bromo-2,3,4-trifluorobenzoate. InChIKey: GJVMADPTUUTJOF-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | methyl 5-bromo-2,3,4-trifluorobenzoate |
| InChIKey | GJVMADPTUUTJOF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1F)F)F)Br |
Computed by PubChem (NCBI)