cas: 936-08-3 — see every product listed under this CAS number, including other names
2-Bromo-4-chlorobenzoic acid 98% (CAS 936-08-3) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A135787-1000g |
| cas | 936-08-3 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 3407.50 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 186.81 Pln | |
| Ambeed | 100g | 487.19 Pln | |
| Ambeed | 500g | 2155.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A135787 |
2-bromo-4-chlorobenzoic acid (CAS 936-08-3) is a chemical compound with the molecular formula C7H4BrClO2 and a molecular weight of 235.46 g/mol. IUPAC name: 2-bromo-4-chlorobenzoic acid. InChIKey: USMQLFCVCDEXAK-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO2 |
|---|---|
| Molecular weight | 235.46 g/mol |
| IUPAC name | 2-bromo-4-chlorobenzoic acid |
| InChIKey | USMQLFCVCDEXAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Br)C(=O)O |
Computed by PubChem (NCBI)