CAS 72736-55-1 appears in our catalog under these names: 6-Bromo-4-chloro-2H-1,3-benzodioxole, 98%, 6-BRomo-4-chloro-2H-1,3-benzodioxole, 95%, 6-Bromo-4-chloro-1,3-dioxaindane. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg.
6-bromo-4-chloro-1,3-benzodioxole (CAS 72736-55-1) is a chemical compound with the molecular formula C7H4BrClO2 and a molecular weight of 235.46 g/mol. IUPAC name: 6-bromo-4-chloro-1,3-benzodioxole. InChIKey: JBMQHJLNVUKDHJ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO2 |
|---|---|
| Molecular weight | 235.46 g/mol |
| IUPAC name | 6-bromo-4-chloro-1,3-benzodioxole |
| InChIKey | JBMQHJLNVUKDHJ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)