CAS 59748-90-2 appears in our catalog under these names: 4-Bromo-2-Chlorobenzoic Acid, 4-Bromo-2-chlorobenzoic acid 98%, 4-BROMO-2-CHLOROBENZOIC ACID, 97%, 4-Bromo-2-chlorobenzoic acid, 98%, 4-Bromo-2-chlorobenzoic Acid, >98.0%(T). Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: on request, 10g, 1g, 5g, 25g, 100g, 500g, 1000g.
4-bromo-2-chlorobenzoic acid (CAS 59748-90-2) is a chemical compound with the molecular formula C7H4BrClO2 and a molecular weight of 235.46 g/mol. IUPAC name: 4-bromo-2-chlorobenzoic acid. InChIKey: JAVZWSOFJKYSDY-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO2 |
|---|---|
| Molecular weight | 235.46 g/mol |
| IUPAC name | 4-bromo-2-chlorobenzoic acid |
| InChIKey | JAVZWSOFJKYSDY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)C(=O)O |
Computed by PubChem (NCBI)