CAS 1849-76-9 appears in our catalog under these names: 3-Bromo-5-chloro-4-hydroxybenzaldehyde, 97%, 3-Bromo-5-chloro-4-hydroxybenzaldehyde, 3-Bromo-5-chloro-4-hydroxybenzaldehyde 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 250mg.
3-bromo-5-chloro-4-hydroxybenzaldehyde (CAS 1849-76-9) is a chemical compound with the molecular formula C7H4BrClO2 and a molecular weight of 235.46 g/mol. IUPAC name: 3-bromo-5-chloro-4-hydroxybenzaldehyde. InChIKey: ITSXSHQWMYYQQY-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO2 |
|---|---|
| Molecular weight | 235.46 g/mol |
| IUPAC name | 3-bromo-5-chloro-4-hydroxybenzaldehyde |
| InChIKey | ITSXSHQWMYYQQY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)O)Br)C=O |
Computed by PubChem (NCBI)