CAS 93224-85-2 appears in our catalog under these names: 2-Bromo-6-chlorobenzoic Acid, 2–Bromo–6–chlorobenzoic acid, 2-Bromo-6-chlorobenzoic acid, 98% , 2-Bromo-6-chlorobenzoic acid 98%, 2-Bromo-6-chlorobenzoic acid, 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem. Available pack sizes: 1g, 2,5g, 5g, 100g, 25g, 500g, 1000g, 10g.
2-bromo-6-chlorobenzoic acid (CAS 93224-85-2) is a chemical compound with the molecular formula C7H4BrClO2 and a molecular weight of 235.46 g/mol. IUPAC name: 2-bromo-6-chlorobenzoic acid. InChIKey: URGXUQODOUMRFP-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO2 |
|---|---|
| Molecular weight | 235.46 g/mol |
| IUPAC name | 2-bromo-6-chlorobenzoic acid |
| InChIKey | URGXUQODOUMRFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(=O)O)Cl |
Computed by PubChem (NCBI)