CAS 42860-02-6 appears in our catalog under these names: 3–Bromo–5–chlorobenzoic Acid, 3-Bromo-5-chlorobenzoic Acid, >98.0%(GC)(T), 3-Bromo-5-chlorobenzoic acid 98%, 3-Bromo-5-chlorobenzoic acid, 95%. Offered by: GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 1000g, 10g, 500g, 1kg.
3-bromo-5-chlorobenzoic acid (CAS 42860-02-6) is a chemical compound with the molecular formula C7H4BrClO2 and a molecular weight of 235.46 g/mol. IUPAC name: 3-bromo-5-chlorobenzoic acid. InChIKey: PBRRUJWXRUGGAW-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClO2 |
|---|---|
| Molecular weight | 235.46 g/mol |
| IUPAC name | 3-bromo-5-chlorobenzoic acid |
| InChIKey | PBRRUJWXRUGGAW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Br)C(=O)O |
Computed by PubChem (NCBI)