cas: 866633-25-2 — see every product listed under this CAS number, including other names
2-Bromo-4-fluoro-1-(trifluoromethoxy)benzene 98% (CAS 866633-25-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A217527-100mg |
| cas | 866633-25-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 876.56 Pln | |
| Ambeed | 25g | 3151.62 Pln | |
| Ambeed | 100g | 9926.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A217527 |
2-bromo-4-fluoro-1-(trifluoromethoxy)benzene (CAS 866633-25-2) is a chemical compound with the molecular formula C7H3BrF4O and a molecular weight of 259.00 g/mol. IUPAC name: 2-bromo-4-fluoro-1-(trifluoromethoxy)benzene. InChIKey: TUMXMNZWNKIGIE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4O |
|---|---|
| Molecular weight | 259.00 g/mol |
| IUPAC name | 2-bromo-4-fluoro-1-(trifluoromethoxy)benzene |
| InChIKey | TUMXMNZWNKIGIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)OC(F)(F)F |
Computed by PubChem (NCBI)