2-Bromo-4-methoxybenzenesulfonyl chloride, 98%
cas: 23095-16-1 — see every product listed under this CAS number, including other names
2-Bromo-4-methoxybenzenesulfonyl chloride, 98% (CAS 23095-16-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A728640-100mg |
| cas | 23095-16-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 642.94 Pln | |
| Ambeed | 5g | 2055.81 Pln | |
| Ambeed | 10g | 3440.88 Pln | |
| Ambeed | 25g | 8052.19 Pln | |
| Fluorochem | 1g | 664.37 Pln | |
| Fluorochem | 5g | 2106.57 Pln | |
| Fluorochem | 10g | 3507.12 Pln | |
| Fluorochem | 25g | 8078.42 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-4-methoxybenzenesulfonyl chloride (CAS 23095-16-1) is a chemical compound with the molecular formula C7H6BrClO3S and a molecular weight of 285.54 g/mol. IUPAC name: 2-bromo-4-methoxybenzenesulfonyl chloride. InChIKey: NRNTWMTVYWBKSM-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO3S |
|---|---|
| Molecular weight | 285.54 g/mol |
| IUPAC name | 2-bromo-4-methoxybenzenesulfonyl chloride |
| InChIKey | NRNTWMTVYWBKSM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)